C15H12N2O2S — CID 170756201
2-amino-5-[2-(1,3-thiazol-5-yl)phenoxy]phenol (PubChem CID 170756201) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-amino-5-[2-(1,3-thiazol-5-yl)phenoxy]phenol.
| Compound Name | 2-amino-5-[2-(1,3-thiazol-5-yl)phenoxy]phenol |
|---|---|
| PubChem CID | 170756201 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-amino-5-[2-(1,3-thiazol-5-yl)phenoxy]phenol |
| SMILES | Nc1ccc(Oc2ccccc2-c2cncs2)cc1O |
| InChI | InChI=1S/C15H12N2O2S/c16-12-6-5-10(7-13(12)18)19-14-4-2-1-3-11(14)15-8-17-9-20-15/h1-9,18H,16H2 |
| InChIKey | ZWQDJUOHJFCYCQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|