C18H22BrF3O2 — CID 170757038
tert-butyl 6-(bromomethyl)-2-(4,4-difluorocyclohexyl)-3-fluorobenzoate (PubChem CID 170757038) has the molecular formula C18H22BrF3O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is tert-butyl 6-(bromomethyl)-2-(4,4-difluorocyclohexyl)-3-fluorobenzoate.
| Compound Name | tert-butyl 6-(bromomethyl)-2-(4,4-difluorocyclohexyl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 170757038 |
| Molecular Formula | C18H22BrF3O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | tert-butyl 6-(bromomethyl)-2-(4,4-difluorocyclohexyl)-3-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1c(CBr)ccc(F)c1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H22BrF3O2/c1-17(2,3)24-16(23)15-12(10-19)4-5-13(20)14(15)11-6-8-18(21,22)9-7-11/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | PIIJDBBPTVGFRW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|