C26H34N2O2 — CID 170772009
tert-butyl 2-benzhydryl-2,9-diazaspiro[3.6]decane-9-carboxylate (PubChem CID 170772009) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl 2-benzhydryl-2,9-diazaspiro[3.6]decane-9-carboxylate.
| Compound Name | tert-butyl 2-benzhydryl-2,9-diazaspiro[3.6]decane-9-carboxylate |
|---|---|
| PubChem CID | 170772009 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tert-butyl 2-benzhydryl-2,9-diazaspiro[3.6]decane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC2(C1)CN(C(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C26H34N2O2/c1-25(2,3)30-24(29)27-17-11-10-16-26(18-27)19-28(20-26)23(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-9,12-15,23H,10-11,16-20H2,1-3H3 |
| InChIKey | PALNGBZJWWDQTF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |