C8H13F2N — CID 170772159
4-(difluoromethylidene)-1,2-dimethylpiperidine (PubChem CID 170772159) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,2-dimethylpiperidine.
| Compound Name | 4-(difluoromethylidene)-1,2-dimethylpiperidine |
|---|---|
| PubChem CID | 170772159 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-(difluoromethylidene)-1,2-dimethylpiperidine |
| SMILES | CC1CC(=C(F)F)CCN1C |
| InChI | InChI=1S/C8H13F2N/c1-6-5-7(8(9)10)3-4-11(6)2/h6H,3-5H2,1-2H3 |
| InChIKey | ROCGLKWPAALEPN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |