C11H12N2O4 — CID 170773175
trans-methyl (1S,2S)-2-(4-methyl-5-nitro-3-pyridinyl)cyclopropane-1-carboxylate (PubChem CID 170773175) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(4-methyl-5-nitro-3-pyridinyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(4-methyl-5-nitro-3-pyridinyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 170773175 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | trans-methyl (1S,2S)-2-(4-methyl-5-nitro-3-pyridinyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1c1cncc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H12N2O4/c1-6-9(4-12-5-10(6)13(15)16)7-3-8(7)11(14)17-2/h4-5,7-8H,3H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | KXZQKLJDMKJSST-YUMQZZPRSA-N |
| XLogP | 1.57 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|