C15H15FN2O5 — CID 175231610
methyl 2-(5-fluoro-6-nitro-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 175231610) has the molecular formula C15H15FN2O5 and a molecular weight of 322.29 g/mol. Its IUPAC name is methyl 2-(5-fluoro-6-nitro-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate.
| Compound Name | methyl 2-(5-fluoro-6-nitro-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 175231610 |
| Molecular Formula | C15H15FN2O5 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl 2-(5-fluoro-6-nitro-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1c1nc2cc(F)c([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C15H15FN2O5/c1-22-15(19)9-5-3-2-4-8(9)14-17-11-6-10(16)12(18(20)21)7-13(11)23-14/h6-9H,2-5H2,1H3 |
| InChIKey | AHJFDBZXYWUGKG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|