C15H14FN3O5 — CID 169268559
methyl 3-[2-(3-fluoro-4-methyl-5-nitrophenyl)-1,3-oxazol-4-yl]azetidine-1-carboxylate (PubChem CID 169268559) has the molecular formula C15H14FN3O5 and a molecular weight of 335.29 g/mol. Its IUPAC name is methyl 3-[2-(3-fluoro-4-methyl-5-nitrophenyl)-1,3-oxazol-4-yl]azetidine-1-carboxylate.
| Compound Name | methyl 3-[2-(3-fluoro-4-methyl-5-nitrophenyl)-1,3-oxazol-4-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 169268559 |
| Molecular Formula | C15H14FN3O5 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 3-[2-(3-fluoro-4-methyl-5-nitrophenyl)-1,3-oxazol-4-yl]azetidine-1-carboxylate |
| SMILES | COC(=O)N1CC(c2coc(-c3cc(F)c(C)c([N+](=O)[O-])c3)n2)C1 |
| InChI | InChI=1S/C15H14FN3O5/c1-8-11(16)3-9(4-13(8)19(21)22)14-17-12(7-24-14)10-5-18(6-10)15(20)23-2/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | UYQYLMRKSZQQDW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|