About 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione
2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione (PubChem CID 170776049) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione.
Molecular Properties
| Compound Name | 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione |
| PubChem CID | 170776049 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione |
| SMILES | Cn1ncc2c[nH]c(=O)cc2c1=O |
| InChI | InChI=1S/C8H7N3O2/c1-11-8(13)6-2-7(12)9-3-5(6)4-10-11/h2-4H,1H3,(H,9,12) |
| InChIKey | XKGNWPOZGHDWII-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione?
The IUPAC name of 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione (CID 170776049) is 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione.
What is the SMILES notation for 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione?
The canonical SMILES for 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione is Cn1ncc2c[nH]c(=O)cc2c1=O.
What is the InChIKey of 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione?
The InChIKey is XKGNWPOZGHDWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-11-8(13)6-2-7(12)9-3-5(6)4-10-11/h2-4H,1H3,(H,9,12).
What are the key properties of 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione?
2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione has a molecular weight of 177.16 g/mol, XLogP of -0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6H-pyrido[3,4-d]pyridazine-1,7-dione is sourced from PubChem (CID 170776049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).