C15H16O5Se — CID 170776979
(2S)-4-(5,6-dimethoxy-1-benzoselenophen-2-yl)-2-methyl-4-oxobutanoic acid (PubChem CID 170776979) has the molecular formula C15H16O5Se and a molecular weight of 355.25 g/mol. Its IUPAC name is (2S)-4-(5,6-dimethoxy-1-benzoselenophen-2-yl)-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-(5,6-dimethoxy-1-benzoselenophen-2-yl)-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170776979 |
| Molecular Formula | C15H16O5Se |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (2S)-4-(5,6-dimethoxy-1-benzoselenophen-2-yl)-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2cc(C(=O)C[C@H](C)C(=O)O)[se]c2cc1OC |
| InChI | InChI=1S/C15H16O5Se/c1-8(15(17)18)4-10(16)14-6-9-5-11(19-2)12(20-3)7-13(9)21-14/h5-8H,4H2,1-3H3,(H,17,18)/t8-/m0/s1 |
| InChIKey | IZWDQUHPJLZFKJ-QMMMGPOBSA-N |
| XLogP | 2.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|