C29H29NO9Se2 — CID 175463375
4-[5-[3-[[2-(3-carboxypropanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propylamino]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanoic acid (PubChem CID 175463375) has the molecular formula C29H29NO9Se2 and a molecular weight of 693.47 g/mol. Its IUPAC name is 4-[5-[3-[[2-(3-carboxypropanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propylamino]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[3-[[2-(3-carboxypropanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propylamino]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175463375 |
| Molecular Formula | C29H29NO9Se2 |
| Molecular Weight | 693.47 g/mol |
| Exact Mass | 695.02 |
| IUPAC Name | 4-[5-[3-[[2-(3-carboxypropanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propylamino]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanoic acid |
| SMILES | COc1cc2[se]c(C(=O)CCC(=O)O)cc2cc1NCCCOc1cc2cc(C(=O)CCC(=O)O)[se]c2cc1OC |
| InChI | InChI=1S/C29H29NO9Se2/c1-37-21-14-24-16(12-26(40-24)19(31)4-6-28(33)34)10-18(21)30-8-3-9-39-23-11-17-13-27(20(32)5-7-29(35)36)41-25(17)15-22(23)38-2/h10-15,30H,3-9H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | WROWVXLVFFPVIX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|