C29H30N2O8Se2 — CID 175904366
4-[5-[3-[[2-(4-amino-4-oxobutanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propoxy]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanamide (PubChem CID 175904366) has the molecular formula C29H30N2O8Se2 and a molecular weight of 692.48 g/mol. Its IUPAC name is 4-[5-[3-[[2-(4-amino-4-oxobutanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propoxy]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanamide.
| Compound Name | 4-[5-[3-[[2-(4-amino-4-oxobutanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propoxy]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 175904366 |
| Molecular Formula | C29H30N2O8Se2 |
| Molecular Weight | 692.48 g/mol |
| Exact Mass | 694.03 |
| IUPAC Name | 4-[5-[3-[[2-(4-amino-4-oxobutanoyl)-6-methoxy-1-benzoselenophen-5-yl]oxy]propoxy]-6-methoxy-1-benzoselenophen-2-yl]-4-oxobutanamide |
| SMILES | COc1cc2[se]c(C(=O)CCC(N)=O)cc2cc1OCCCOc1cc2cc(C(=O)CCC(N)=O)[se]c2cc1OC |
| InChI | InChI=1S/C29H30N2O8Se2/c1-36-20-14-24-16(12-26(40-24)18(32)4-6-28(30)34)10-22(20)38-8-3-9-39-23-11-17-13-27(19(33)5-7-29(31)35)41-25(17)15-21(23)37-2/h10-15H,3-9H2,1-2H3,(H2,30,34)(H2,31,35) |
| InChIKey | AHIGUPQVGXCLAK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|