C20H27F3N4O3S — CID 170777496
1-[3-[3-(4-aminophenyl)sulfonyl-3,9-diazaspiro[5.5]undecan-9-yl]azetidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 170777496) has the molecular formula C20H27F3N4O3S and a molecular weight of 460.52 g/mol. Its IUPAC name is 1-[3-[3-(4-aminophenyl)sulfonyl-3,9-diazaspiro[5.5]undecan-9-yl]azetidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-[3-(4-aminophenyl)sulfonyl-3,9-diazaspiro[5.5]undecan-9-yl]azetidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 170777496 |
| Molecular Formula | C20H27F3N4O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[3-[3-(4-aminophenyl)sulfonyl-3,9-diazaspiro[5.5]undecan-9-yl]azetidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(S(=O)(=O)N2CCC3(CCN(C4CN(C(=O)C(F)(F)F)C4)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H27F3N4O3S/c21-20(22,23)18(28)26-13-16(14-26)25-9-5-19(6-10-25)7-11-27(12-8-19)31(29,30)17-3-1-15(24)2-4-17/h1-4,16H,5-14,24H2 |
| InChIKey | XFLPFYCWQVTTIA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|