C13H18BrNO2 — CID 170781413
[3-(1-bromo-2,2-dimethylpropyl)phenyl]methyl carbamate (PubChem CID 170781413) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is [3-(1-bromo-2,2-dimethylpropyl)phenyl]methyl carbamate.
| Compound Name | [3-(1-bromo-2,2-dimethylpropyl)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 170781413 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | [3-(1-bromo-2,2-dimethylpropyl)phenyl]methyl carbamate |
| SMILES | CC(C)(C)C(Br)c1cccc(COC(N)=O)c1 |
| InChI | InChI=1S/C13H18BrNO2/c1-13(2,3)11(14)10-6-4-5-9(7-10)8-17-12(15)16/h4-7,11H,8H2,1-3H3,(H2,15,16) |
| InChIKey | JHOFLMFATDECDM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|