C17H18N4O2 — CID 170783331
methyl 2-[4-(4-cyanopyrazol-1-yl)piperidin-2-yl]benzoate (PubChem CID 170783331) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is methyl 2-[4-(4-cyanopyrazol-1-yl)piperidin-2-yl]benzoate.
| Compound Name | methyl 2-[4-(4-cyanopyrazol-1-yl)piperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 170783331 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 2-[4-(4-cyanopyrazol-1-yl)piperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1C1CC(n2cc(C#N)cn2)CCN1 |
| InChI | InChI=1S/C17H18N4O2/c1-23-17(22)15-5-3-2-4-14(15)16-8-13(6-7-19-16)21-11-12(9-18)10-20-21/h2-5,10-11,13,16,19H,6-8H2,1H3 |
| InChIKey | XHGDBFUYNSPVNG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |