C23H29N7O3S — CID 17078508
(1Z)-1-[[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea (PubChem CID 17078508) has the molecular formula C23H29N7O3S and a molecular weight of 483.60 g/mol. Its IUPAC name is (1Z)-1-[[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea.
| Compound Name | (1Z)-1-[[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea |
|---|---|
| PubChem CID | 17078508 |
| Molecular Formula | C23H29N7O3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (1Z)-1-[[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea |
| SMILES | CCNC(=S)/N=C(/Nc1nc(C)cc(C)n1)N1CCN(C(=O)C2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C23H29N7O3S/c1-4-24-23(34)28-22(27-21-25-15(2)13-16(3)26-21)30-11-9-29(10-12-30)20(31)19-14-32-17-7-5-6-8-18(17)33-19/h5-8,13,19H,4,9-12,14H2,1-3H3,(H2,24,25,26,27,28,34) |
| InChIKey | HORMGMSMPCYLKX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|