C22H26N2O6 — CID 170787889
1-[3-(2,2-dimethoxyethoxy)phenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 170787889) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[3-(2,2-dimethoxyethoxy)phenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-(2,2-dimethoxyethoxy)phenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 170787889 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[3-(2,2-dimethoxyethoxy)phenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3cccc(OCC(OC)OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-27-18-9-7-16(8-10-18)14-24-20(25)11-12-23(22(24)26)17-5-4-6-19(13-17)30-15-21(28-2)29-3/h4-10,13,21H,11-12,14-15H2,1-3H3 |
| InChIKey | YUQOVBJNNAGAJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|