C17H16BrN3O3 — CID 176890550
1-(2-bromo-4-pyridinyl)-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 176890550) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2-bromo-4-pyridinyl)-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176890550 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3ccnc(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C17H16BrN3O3/c1-24-14-4-2-12(3-5-14)11-21-16(22)7-9-20(17(21)23)13-6-8-19-15(18)10-13/h2-6,8,10H,7,9,11H2,1H3 |
| InChIKey | OJJQAIPDXWTLQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|