C26H23N3O4 — CID 170789618
N-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-oxo-1-(2-oxoethyl)pyrimidin-5-yl]-4-phenoxybenzamide (PubChem CID 170789618) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-oxo-1-(2-oxoethyl)pyrimidin-5-yl]-4-phenoxybenzamide.
| Compound Name | N-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-oxo-1-(2-oxoethyl)pyrimidin-5-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 170789618 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-oxo-1-(2-oxoethyl)pyrimidin-5-yl]-4-phenoxybenzamide |
| SMILES | C=C/C(=C\C=C/C)c1ncc(NC(=O)c2ccc(Oc3ccccc3)cc2)c(=O)n1CC=O |
| InChI | InChI=1S/C26H23N3O4/c1-3-5-9-19(4-2)24-27-18-23(26(32)29(24)16-17-30)28-25(31)20-12-14-22(15-13-20)33-21-10-7-6-8-11-21/h3-15,17-18H,2,16H2,1H3,(H,28,31)/b5-3-,19-9+ |
| InChIKey | LKIFEMZYEURNBD-HDBHHNSQSA-N |
| XLogP | 4.63 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|