C61H111NO5 — CID 170790542
heptadecan-9-yl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate (PubChem CID 170790542) has the molecular formula C61H111NO5 and a molecular weight of 938.56 g/mol. Its IUPAC name is heptadecan-9-yl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate.
| Compound Name | heptadecan-9-yl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate |
|---|---|
| PubChem CID | 170790542 |
| Molecular Formula | C61H111NO5 |
| Molecular Weight | 938.56 g/mol |
| Exact Mass | 937.85 |
| IUPAC Name | heptadecan-9-yl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCN(CCCCO)CCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C61H111NO5/c1-8-10-12-14-16-21-32-52(33-22-17-15-13-11-9-2)66-58(64)34-23-18-19-25-44-62(46-27-28-47-63)45-26-20-24-35-59(65)67-53-40-42-60(6)51(48-53)36-37-54-56-39-38-55(50(5)31-29-30-49(3)4)61(56,7)43-41-57(54)60/h36,49-50,52-57,63H,8-35,37-48H2,1-7H3 |
| InChIKey | AXEUWRLHLZLAEW-UHFFFAOYSA-N |
| XLogP | 16.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.56 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|