C60H111NO5 — CID 177220096
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[7,7-dioctoxyheptyl(4-hydroxybutyl)amino]hexanoate (PubChem CID 177220096) has the molecular formula C60H111NO5 and a molecular weight of 926.55 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[7,7-dioctoxyheptyl(4-hydroxybutyl)amino]hexanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[7,7-dioctoxyheptyl(4-hydroxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 177220096 |
| Molecular Formula | C60H111NO5 |
| Molecular Weight | 926.55 g/mol |
| Exact Mass | 925.85 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[7,7-dioctoxyheptyl(4-hydroxybutyl)amino]hexanoate |
| SMILES | CCCCCCCCOC(CCCCCCN(CCCCO)CCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1)OCCCCCCCC |
| InChI | InChI=1S/C60H111NO5/c1-8-10-12-14-18-27-46-64-58(65-47-28-19-15-13-11-9-2)33-22-16-17-23-42-61(44-25-26-45-62)43-24-20-21-32-57(63)66-52-38-40-59(6)51(48-52)34-35-53-55-37-36-54(50(5)31-29-30-49(3)4)60(55,7)41-39-56(53)59/h34,49-50,52-56,58,62H,8-33,35-48H2,1-7H3 |
| InChIKey | WZFRKDQSCOJXEI-UHFFFAOYSA-N |
| XLogP | 16.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.55 |
| LogP ≤ 5 | 16.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|