C50H89NO4S — CID 170790500
hexyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-sulfanylidenehexyl]-(4-hydroxybutyl)amino]heptanoate (PubChem CID 170790500) has the molecular formula C50H89NO4S and a molecular weight of 800.33 g/mol. Its IUPAC name is hexyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-sulfanylidenehexyl]-(4-hydroxybutyl)amino]heptanoate.
| Compound Name | hexyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-sulfanylidenehexyl]-(4-hydroxybutyl)amino]heptanoate |
|---|---|
| PubChem CID | 170790500 |
| Molecular Formula | C50H89NO4S |
| Molecular Weight | 800.33 g/mol |
| Exact Mass | 799.65 |
| IUPAC Name | hexyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-sulfanylidenehexyl]-(4-hydroxybutyl)amino]heptanoate |
| SMILES | CCCCCCOC(=O)CCCCCCN(CCCCO)CCCCCC(=S)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C50H89NO4S/c1-7-8-9-19-37-54-47(53)23-13-10-11-15-33-51(35-17-18-36-52)34-16-12-14-24-48(56)55-42-29-31-49(5)41(38-42)25-26-43-45-28-27-44(40(4)22-20-21-39(2)3)50(45,6)32-30-46(43)49/h25,39-40,42-46,52H,7-24,26-38H2,1-6H3 |
| InChIKey | GBOFNDFDNQXPMM-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.33 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|