C61H113NO5 — CID 177220062
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4,4-didecoxybutyl(4-hydroxybutyl)amino]hexanoate (PubChem CID 177220062) has the molecular formula C61H113NO5 and a molecular weight of 940.58 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4,4-didecoxybutyl(4-hydroxybutyl)amino]hexanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4,4-didecoxybutyl(4-hydroxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 177220062 |
| Molecular Formula | C61H113NO5 |
| Molecular Weight | 940.58 g/mol |
| Exact Mass | 939.86 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4,4-didecoxybutyl(4-hydroxybutyl)amino]hexanoate |
| SMILES | CCCCCCCCCCOC(CCCN(CCCCO)CCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1)OCCCCCCCCCC |
| InChI | InChI=1S/C61H113NO5/c1-8-10-12-14-16-18-20-27-47-65-59(66-48-28-21-19-17-15-13-11-9-2)34-30-45-62(44-25-26-46-63)43-24-22-23-33-58(64)67-53-39-41-60(6)52(49-53)35-36-54-56-38-37-55(51(5)32-29-31-50(3)4)61(56,7)42-40-57(54)60/h35,50-51,53-57,59,63H,8-34,36-49H2,1-7H3 |
| InChIKey | BQNVUHDVJBYARN-UHFFFAOYSA-N |
| XLogP | 17.00 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.58 |
| LogP ≤ 5 | 17.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|