C45H79NO5 — CID 170790562
methyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate (PubChem CID 170790562) has the molecular formula C45H79NO5 and a molecular weight of 714.13 g/mol. Its IUPAC name is methyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate.
| Compound Name | methyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate |
|---|---|
| PubChem CID | 170790562 |
| Molecular Formula | C45H79NO5 |
| Molecular Weight | 714.13 g/mol |
| Exact Mass | 713.60 |
| IUPAC Name | methyl 7-[[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexyl]-(4-hydroxybutyl)amino]heptanoate |
| SMILES | COC(=O)CCCCCCN(CCCCO)CCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C45H79NO5/c1-34(2)17-16-18-35(3)39-23-24-40-38-22-21-36-33-37(25-27-44(36,4)41(38)26-28-45(39,40)5)51-43(49)20-11-9-13-30-46(31-14-15-32-47)29-12-8-7-10-19-42(48)50-6/h21,34-35,37-41,47H,7-20,22-33H2,1-6H3 |
| InChIKey | JMFQNLCYOKFQTN-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.13 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|