C49H89NO4 — CID 170790699
methyl 7-[4-hydroxybutyl(6-oxononyl)amino]heptanoate;3,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 170790699) has the molecular formula C49H89NO4 and a molecular weight of 756.25 g/mol. Its IUPAC name is methyl 7-[4-hydroxybutyl(6-oxononyl)amino]heptanoate;3,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | methyl 7-[4-hydroxybutyl(6-oxononyl)amino]heptanoate;3,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 170790699 |
| Molecular Formula | C49H89NO4 |
| Molecular Weight | 756.25 g/mol |
| Exact Mass | 755.68 |
| IUPAC Name | methyl 7-[4-hydroxybutyl(6-oxononyl)amino]heptanoate;3,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(C)CCC4(C)C3CCC12C.CCCC(=O)CCCCCN(CCCCO)CCCCCCC(=O)OC |
| InChI | InChI=1S/C28H48.C21H41NO4/c1-19(2)8-7-9-21(4)24-12-13-25-23-11-10-22-18-20(3)14-16-27(22,5)26(23)15-17-28(24,25)6;1-3-13-20(24)14-7-6-10-17-22(18-11-12-19-23)16-9-5-4-8-15-21(25)26-2/h10,19-21,23-26H,7-9,11-18H2,1-6H3;23H,3-19H2,1-2H3 |
| InChIKey | ARLSWZUYPYNVRA-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.25 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|