C11H9F3N2O3 — CID 170791467
1-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-nitropyridin-2-one (PubChem CID 170791467) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-nitropyridin-2-one.
| Compound Name | 1-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-nitropyridin-2-one |
|---|---|
| PubChem CID | 170791467 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-nitropyridin-2-one |
| SMILES | O=c1c([N+](=O)[O-])cc(F)cn1C1=CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H9F3N2O3/c12-7-5-9(16(18)19)10(17)15(6-7)8-1-3-11(13,14)4-2-8/h1,5-6H,2-4H2 |
| InChIKey | BGNSDGMRVZUFGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|