C17H20IN4S2- — CID 170792174
CID 170792174 (PubChem CID 170792174) has the molecular formula C17H20IN4S2- and a molecular weight of 471.41 g/mol.
| Compound Name | CID 170792174 |
|---|---|
| PubChem CID | 170792174 |
| Molecular Formula | C17H20IN4S2- |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | — |
| SMILES | Cc1c(C[C@H](C)N)sc2c(NCc3nccs3)cc(C3C[I-]3)nc12 |
| InChI | InChI=1S/C17H20IN4S2/c1-9(19)5-14-10(2)16-17(24-14)13(6-12(22-16)11-7-18-11)21-8-15-20-3-4-23-15/h3-4,6,9,11H,5,7-8,19H2,1-2H3,(H,21,22)/q-1/t9-,11?/m0/s1 |
| InChIKey | MOKOSZVUPQEJHJ-FTNKSUMCSA-N |
| XLogP | 0.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|