C15H13BrClF3N4OS2 — CID 155060079
3-[3-bromo-5-chloro-7-(1,3-thiazol-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-2-(trifluoromethylamino)propan-1-ol (PubChem CID 155060079) has the molecular formula C15H13BrClF3N4OS2 and a molecular weight of 501.78 g/mol. Its IUPAC name is 3-[3-bromo-5-chloro-7-(1,3-thiazol-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-2-(trifluoromethylamino)propan-1-ol.
| Compound Name | 3-[3-bromo-5-chloro-7-(1,3-thiazol-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-2-(trifluoromethylamino)propan-1-ol |
|---|---|
| PubChem CID | 155060079 |
| Molecular Formula | C15H13BrClF3N4OS2 |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 499.94 |
| IUPAC Name | 3-[3-bromo-5-chloro-7-(1,3-thiazol-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-2-(trifluoromethylamino)propan-1-ol |
| SMILES | OCC(Cc1sc2c(NCc3nccs3)cc(Cl)nc2c1Br)NC(F)(F)F |
| InChI | InChI=1S/C15H13BrClF3N4OS2/c16-12-9(3-7(6-25)24-15(18,19)20)27-14-8(4-10(17)23-13(12)14)22-5-11-21-1-2-26-11/h1-2,4,7,24-25H,3,5-6H2,(H,22,23) |
| InChIKey | YDDSNLSSQARXIG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|