C13H12N2O2 — CID 170798671
4-[4-(1,2-oxazol-5-yl)phenyl]but-3-enamide (PubChem CID 170798671) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-enamide.
| Compound Name | 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 170798671 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-enamide |
| SMILES | NC(=O)CC=Cc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C13H12N2O2/c14-13(16)3-1-2-10-4-6-11(7-5-10)12-8-9-15-17-12/h1-2,4-9H,3H2,(H2,14,16) |
| InChIKey | LNISABNIGBJBGT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |