C9H14N2O3 — CID 170817535
1-(3-amino-4-methyl-2-pyridinyl)propane-1,2,3-triol (PubChem CID 170817535) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(3-amino-4-methyl-2-pyridinyl)propane-1,2,3-triol.
| Compound Name | 1-(3-amino-4-methyl-2-pyridinyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817535 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(3-amino-4-methyl-2-pyridinyl)propane-1,2,3-triol |
| SMILES | Cc1ccnc(C(O)C(O)CO)c1N |
| InChI | InChI=1S/C9H14N2O3/c1-5-2-3-11-8(7(5)10)9(14)6(13)4-12/h2-3,6,9,12-14H,4,10H2,1H3 |
| InChIKey | XYCQZIUYXXVWKM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |