C8H8BrNO5 — CID 170825065
3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825065) has the molecular formula C8H8BrNO5 and a molecular weight of 278.06 g/mol. Its IUPAC name is 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825065 |
| Molecular Formula | C8H8BrNO5 |
| Molecular Weight | 278.06 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1nc(Br)ccc1O |
| InChI | InChI=1S/C8H8BrNO5/c9-4-2-1-3(11)5(10-4)6(12)7(13)8(14)15/h1-2,6-7,11-13H,(H,14,15) |
| InChIKey | KDIARVHKNZRUFI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.06 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|