3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid

C8H8BrNO5 — CID 170825065

IUPAC3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)C(O)C(O)c1nc(Br)ccc1O
InChIInChI=1S/C8H8BrNO5/c9-4-2-1-3(11)5(10-4)6(12)7(13)8(14)15/h1-2,6-7,11-13H,(H,14,15)
InChIKeyKDIARVHKNZRUFI-UHFFFAOYSA-N
MW278.06 g/mol
LogP0.03
Rot. Bonds3

About 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid

3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825065) has the molecular formula C8H8BrNO5 and a molecular weight of 278.06 g/mol. Its IUPAC name is 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid.

Molecular Properties

Compound Name3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid
PubChem CID170825065
Molecular FormulaC8H8BrNO5
Molecular Weight278.06 g/mol
Exact Mass276.96
IUPAC Name3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)C(O)C(O)c1nc(Br)ccc1O
InChIInChI=1S/C8H8BrNO5/c9-4-2-1-3(11)5(10-4)6(12)7(13)8(14)15/h1-2,6-7,11-13H,(H,14,15)
InChIKeyKDIARVHKNZRUFI-UHFFFAOYSA-N
XLogP0.03
TPSA110.88 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.06
LogP ≤ 50.03
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid (CID 170825065) is 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid is O=C(O)C(O)C(O)c1nc(Br)ccc1O.
What is the InChIKey of 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid?
The InChIKey is KDIARVHKNZRUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO5/c9-4-2-1-3(11)5(10-4)6(12)7(13)8(14)15/h1-2,6-7,11-13H,(H,14,15).
What are the key properties of 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid?
3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid has a molecular weight of 278.06 g/mol, XLogP of 0.03, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-bromo-3-hydroxy-2-pyridinyl)-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170825065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).