C9H12N4O3 — CID 170829570
N-[3-(5-cyano-1H-pyrazol-4-yl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170829570) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is N-[3-(5-cyano-1H-pyrazol-4-yl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(5-cyano-1H-pyrazol-4-yl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170829570 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-[3-(5-cyano-1H-pyrazol-4-yl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cn[nH]c1C#N |
| InChI | InChI=1S/C9H12N4O3/c1-5(14)11-4-8(15)9(16)6-3-12-13-7(6)2-10/h3,8-9,15-16H,4H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | MUTIRKOBMQBCRC-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |