C29H23N5O2S — CID 170835647
[(Z)-[(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(2-oxochromen-3-yl)prop-2-enylidene]amino]thiourea (PubChem CID 170835647) has the molecular formula C29H23N5O2S and a molecular weight of 505.60 g/mol. Its IUPAC name is [(Z)-[(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(2-oxochromen-3-yl)prop-2-enylidene]amino]thiourea.
| Compound Name | [(Z)-[(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(2-oxochromen-3-yl)prop-2-enylidene]amino]thiourea |
|---|---|
| PubChem CID | 170835647 |
| Molecular Formula | C29H23N5O2S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [(Z)-[(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(2-oxochromen-3-yl)prop-2-enylidene]amino]thiourea |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=N/NC(N)=S)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C29H23N5O2S/c1-19-11-13-20(14-12-19)27-22(18-34(33-27)23-8-3-2-4-9-23)15-16-25(31-32-29(30)37)24-17-21-7-5-6-10-26(21)36-28(24)35/h2-18H,1H3,(H3,30,32,37)/b16-15+,31-25- |
| InChIKey | MUMHNHSNSYPAIR-ZBCPPADHSA-N |
| XLogP | 5.20 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|