C38H32N3O4S- — CID 170839759
N-[4-[(4-anilinocyclohexa-2,5-dien-1-ylidene)-(4-anilinophenyl)methyl]phenyl]-3-methylaniline sulfate (PubChem CID 170839759) has the molecular formula C38H32N3O4S- and a molecular weight of 626.76 g/mol. Its IUPAC name is N-[4-[(4-anilinocyclohexa-2,5-dien-1-ylidene)-(4-anilinophenyl)methyl]phenyl]-3-methylaniline sulfate.
| Compound Name | N-[4-[(4-anilinocyclohexa-2,5-dien-1-ylidene)-(4-anilinophenyl)methyl]phenyl]-3-methylaniline sulfate |
|---|---|
| PubChem CID | 170839759 |
| Molecular Formula | C38H32N3O4S- |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | N-[4-[(4-anilinocyclohexa-2,5-dien-1-ylidene)-(4-anilinophenyl)methyl]phenyl]-3-methylaniline sulfate |
| SMILES | Cc1cccc(Nc2ccc(C(=C3C=C[C+](Nc4ccccc4)C=C3)c3ccc(Nc4ccccc4)cc3)cc2)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C38H32N3.H2O4S/c1-28-9-8-14-37(27-28)41-36-25-19-31(20-26-36)38(29-15-21-34(22-16-29)39-32-10-4-2-5-11-32)30-17-23-35(24-18-30)40-33-12-6-3-7-13-33;1-5(2,3)4/h2-27,39-41H,1H3;(H2,1,2,3,4)/q+1;/p-2 |
| InChIKey | OXSNPVOCHANAEE-UHFFFAOYSA-L |
| XLogP | 8.72 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|