C40H33N3Na2O6S2 — CID 11971402
disodium;2-methyl-4-[4-[[4-(3-methylanilino)phenyl]-[4-(3-methyl-4-sulfonatophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate (PubChem CID 11971402) has the molecular formula C40H33N3Na2O6S2 and a molecular weight of 761.83 g/mol. Its IUPAC name is disodium;2-methyl-4-[4-[[4-(3-methylanilino)phenyl]-[4-(3-methyl-4-sulfonatophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate.
| Compound Name | disodium;2-methyl-4-[4-[[4-(3-methylanilino)phenyl]-[4-(3-methyl-4-sulfonatophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate |
|---|---|
| PubChem CID | 11971402 |
| Molecular Formula | C40H33N3Na2O6S2 |
| Molecular Weight | 761.83 g/mol |
| Exact Mass | 761.16 |
| IUPAC Name | disodium;2-methyl-4-[4-[[4-(3-methylanilino)phenyl]-[4-(3-methyl-4-sulfonatophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate |
| SMILES | Cc1cccc(Nc2ccc(C(=C3C=CC(=Nc4ccc(S(=O)(=O)[O-])c(C)c4)C=C3)c3ccc(Nc4ccc(S(=O)(=O)[O-])c(C)c4)cc3)cc2)c1.[Na+].[Na+] |
| InChI | InChI=1S/C40H35N3O6S2.2Na/c1-26-5-4-6-35(23-26)41-32-13-7-29(8-14-32)40(30-9-15-33(16-10-30)42-36-19-21-38(27(2)24-36)50(44,45)46)31-11-17-34(18-12-31)43-37-20-22-39(28(3)25-37)51(47,48)49;;/h4-25,41-42H,1-3H3,(H,44,45,46)(H,47,48,49);;/q;2*+1/p-2/b40-31-,43-34+;; |
| InChIKey | BSYWGPDWFWXDCJ-LKKOYEFJSA-L |
| XLogP | 2.62 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|