C19H31N3O4 — CID 170841416
N-[4-ethyl-7-(prop-2-enoylamino)-4-[(prop-2-enoylamino)methoxy]heptyl]prop-2-enamide (PubChem CID 170841416) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[4-ethyl-7-(prop-2-enoylamino)-4-[(prop-2-enoylamino)methoxy]heptyl]prop-2-enamide.
| Compound Name | N-[4-ethyl-7-(prop-2-enoylamino)-4-[(prop-2-enoylamino)methoxy]heptyl]prop-2-enamide |
|---|---|
| PubChem CID | 170841416 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | N-[4-ethyl-7-(prop-2-enoylamino)-4-[(prop-2-enoylamino)methoxy]heptyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC(CC)(CCCNC(=O)C=C)OCNC(=O)C=C |
| InChI | InChI=1S/C19H31N3O4/c1-5-16(23)20-13-9-11-19(8-4,26-15-22-18(25)7-3)12-10-14-21-17(24)6-2/h5-7H,1-3,8-15H2,4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | VRNMEMRLQPUTNX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|