C13H7N3Na2O10S — CID 170841660
disodium;2-[(5-carboxy-2-hydroxy-4-oxidophenyl)diazenyl]-6-nitro-4-sulfophenolate (PubChem CID 170841660) has the molecular formula C13H7N3Na2O10S and a molecular weight of 443.26 g/mol. Its IUPAC name is disodium;2-[(5-carboxy-2-hydroxy-4-oxidophenyl)diazenyl]-6-nitro-4-sulfophenolate.
| Compound Name | disodium;2-[(5-carboxy-2-hydroxy-4-oxidophenyl)diazenyl]-6-nitro-4-sulfophenolate |
|---|---|
| PubChem CID | 170841660 |
| Molecular Formula | C13H7N3Na2O10S |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | disodium;2-[(5-carboxy-2-hydroxy-4-oxidophenyl)diazenyl]-6-nitro-4-sulfophenolate |
| SMILES | O=C(O)c1cc(/N=N/c2cc(S(=O)(=O)O)cc([N+](=O)[O-])c2[O-])c(O)cc1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H9N3O10S.2Na/c17-10-4-11(18)7(3-6(10)13(20)21)14-15-8-1-5(27(24,25)26)2-9(12(8)19)16(22)23;;/h1-4,17-19H,(H,20,21)(H,24,25,26);;/q;2*+1/p-2/b15-14+;; |
| InChIKey | DRNABAUJRSESTF-NSKUCRDLSA-L |
| XLogP | -5.18 |
| TPSA | 225.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|