About sodium;gold(1+);3-sulfidopropane-1-sulfonate
sodium;gold(1+);3-sulfidopropane-1-sulfonate (PubChem CID 170845901) has the molecular formula C3H6AuNaO3S2
and a molecular weight of 374.17 g/mol. Its IUPAC name is sodium;gold(1+);3-sulfidopropane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;gold(1+);3-sulfidopropane-1-sulfonate |
| PubChem CID | 170845901 |
| Molecular Formula | C3H6AuNaO3S2 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | sodium;gold(1+);3-sulfidopropane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[S-].[Au+].[Na+] |
| InChI | InChI=1S/C3H8O3S2.Au.Na/c4-8(5,6)3-1-2-7;;/h7H,1-3H2,(H,4,5,6);;/q;2*+1/p-2 |
| InChIKey | WOLXJRXGXFWGFI-UHFFFAOYSA-L |
| XLogP | -3.53 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;gold(1+);3-sulfidopropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;gold(1+);3-sulfidopropane-1-sulfonate?
The IUPAC name of sodium;gold(1+);3-sulfidopropane-1-sulfonate (CID 170845901) is sodium;gold(1+);3-sulfidopropane-1-sulfonate.
What is the SMILES notation for sodium;gold(1+);3-sulfidopropane-1-sulfonate?
The canonical SMILES for sodium;gold(1+);3-sulfidopropane-1-sulfonate is O=S(=O)([O-])CCC[S-].[Au+].[Na+].
What is the InChIKey of sodium;gold(1+);3-sulfidopropane-1-sulfonate?
The InChIKey is WOLXJRXGXFWGFI-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H8O3S2.Au.Na/c4-8(5,6)3-1-2-7;;/h7H,1-3H2,(H,4,5,6);;/q;2*+1/p-2.
What are the key properties of sodium;gold(1+);3-sulfidopropane-1-sulfonate?
sodium;gold(1+);3-sulfidopropane-1-sulfonate has a molecular weight of 374.17 g/mol, XLogP of -3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;gold(1+);3-sulfidopropane-1-sulfonate is sourced from PubChem (CID 170845901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).