C12H25NO — CID 170847895
N,N,2-triethyl-4-methylpentanamide (PubChem CID 170847895) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N,N,2-triethyl-4-methylpentanamide.
| Compound Name | N,N,2-triethyl-4-methylpentanamide |
|---|---|
| PubChem CID | 170847895 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N,N,2-triethyl-4-methylpentanamide |
| SMILES | CCC(CC(C)C)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H25NO/c1-6-11(9-10(4)5)12(14)13(7-2)8-3/h10-11H,6-9H2,1-5H3 |
| InChIKey | YOYSADPWTXEJDI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |