C10H17AlO5 — CID 170854455
aluminum;butane-1,3-diolate;(Z)-4-ethoxy-4-oxobut-2-en-2-olate (PubChem CID 170854455) has the molecular formula C10H17AlO5 and a molecular weight of 244.22 g/mol. Its IUPAC name is aluminum;butane-1,3-diolate;(Z)-4-ethoxy-4-oxobut-2-en-2-olate.
| Compound Name | aluminum;butane-1,3-diolate;(Z)-4-ethoxy-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 170854455 |
| Molecular Formula | C10H17AlO5 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | aluminum;butane-1,3-diolate;(Z)-4-ethoxy-4-oxobut-2-en-2-olate |
| SMILES | CC([O-])CC[O-].CCOC(=O)/C=C(/C)[O-].[Al+3] |
| InChI | InChI=1S/C6H10O3.C4H8O2.Al/c1-3-9-6(8)4-5(2)7;1-4(6)2-3-5;/h4,7H,3H2,1-2H3;4H,2-3H2,1H3;/q;-2;+3/p-1/b5-4-;; |
| InChIKey | VLWUFHFVPVVMHY-WNCVTPEDSA-M |
| XLogP | -2.08 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|