C15H16N8O — CID 170855926
6-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,2,4,5-tetrazin-3-amine (PubChem CID 170855926) has the molecular formula C15H16N8O and a molecular weight of 324.35 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,2,4,5-tetrazin-3-amine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 170855926 |
| Molecular Formula | C15H16N8O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,2,4,5-tetrazin-3-amine |
| SMILES | COc1ccc(/C=N/Nc2nnc(-n3nc(C)cc3C)nn2)cc1 |
| InChI | InChI=1S/C15H16N8O/c1-10-8-11(2)23(22-10)15-20-18-14(19-21-15)17-16-9-12-4-6-13(24-3)7-5-12/h4-9H,1-3H3,(H,17,18,19)/b16-9+ |
| InChIKey | FYFYQAVXEJFXHF-CXUHLZMHSA-N |
| XLogP | 1.52 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|