C19H17N7O2 — CID 170856215
N'-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazine-2-carboximidamide (PubChem CID 170856215) has the molecular formula C19H17N7O2 and a molecular weight of 375.39 g/mol. Its IUPAC name is N'-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazine-2-carboximidamide.
| Compound Name | N'-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 170856215 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N'-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazine-2-carboximidamide |
| SMILES | N/C(=N/N=C\c1ccccc1O)c1nccnc1N/N=C/c1ccccc1O |
| InChI | InChI=1S/C19H17N7O2/c20-18(25-23-11-13-5-1-3-7-15(13)27)17-19(22-10-9-21-17)26-24-12-14-6-2-4-8-16(14)28/h1-12,27-28H,(H2,20,25)(H,22,26)/b23-11-,24-12+ |
| InChIKey | UMOBTRUZHFEFSN-QEUMEHMPSA-N |
| XLogP | 2.07 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|