C11H16N6OS — CID 170856500
methyl (4Z)-N-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]morpholine-4-carboximidothioate (PubChem CID 170856500) has the molecular formula C11H16N6OS and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (4Z)-N-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]morpholine-4-carboximidothioate.
| Compound Name | methyl (4Z)-N-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]morpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 170856500 |
| Molecular Formula | C11H16N6OS |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl (4Z)-N-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]morpholine-4-carboximidothioate |
| SMILES | CS/C(=N\N=C(/N)c1ncccn1)N1CCOCC1 |
| InChI | InChI=1S/C11H16N6OS/c1-19-11(17-5-7-18-8-6-17)16-15-9(12)10-13-3-2-4-14-10/h2-4H,5-8H2,1H3,(H2,12,15)/b16-11- |
| InChIKey | NAEKPEVVUSAPRJ-WJDWOHSUSA-N |
| XLogP | 0.15 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|