C22H37Cl2N5O2 — CID 170861434
2-(4-methylpiperazin-1-yl)-1-[4-(4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 170861434) has the molecular formula C22H37Cl2N5O2 and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1-[4-(4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-methylpiperazin-1-yl)-1-[4-(4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 170861434 |
| Molecular Formula | C22H37Cl2N5O2 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1-[4-(4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | CN1CCN(CC(=O)N2CCN(c3ccc(OC4CCNCC4)cc3)CC2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H35N5O2.2ClH/c1-24-10-12-25(13-11-24)18-22(28)27-16-14-26(15-17-27)19-2-4-20(5-3-19)29-21-6-8-23-9-7-21;;/h2-5,21,23H,6-18H2,1H3;2*1H |
| InChIKey | CGSDMOGBRPDGJW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|