C24H25N3O2 — CID 170861567
1-[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 170861567) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 170861567 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(CC(=O)c2cccc(/N=C/c3c(O)ccc4ccccc34)c2)CC1 |
| InChI | InChI=1S/C24H25N3O2/c1-26-11-13-27(14-12-26)17-24(29)19-6-4-7-20(15-19)25-16-22-21-8-3-2-5-18(21)9-10-23(22)28/h2-10,15-16,28H,11-14,17H2,1H3/b25-16+ |
| InChIKey | STPIBWAVCLRZKR-PCLIKHOPSA-N |
| XLogP | 3.73 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|