C14H16F4N2O — CID 170861844
1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 170861844) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 170861844 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[5-fluoro-2-(trifluoromethyl)phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(CC(=O)c2cc(F)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H16F4N2O/c1-19-4-6-20(7-5-19)9-13(21)11-8-10(15)2-3-12(11)14(16,17)18/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | SWGXOZLGVVLABU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |