C19H20F5NO2 — CID 170865479
3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-N,N-dimethylpropan-1-amine (PubChem CID 170865479) has the molecular formula C19H20F5NO2 and a molecular weight of 389.36 g/mol. Its IUPAC name is 3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865479 |
| Molecular Formula | C19H20F5NO2 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc(CCCN(C)C)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H20F5NO2/c1-25(2)8-4-5-11-6-7-13(26-3)12(9-11)10-27-19-17(23)15(21)14(20)16(22)18(19)24/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | OFUWBMKMGDJVBZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|