C9H10NNaO5S — CID 170871514
sodium 2-(1-amino-2-carboxyethyl)benzenesulfonate (PubChem CID 170871514) has the molecular formula C9H10NNaO5S and a molecular weight of 267.24 g/mol. Its IUPAC name is sodium 2-(1-amino-2-carboxyethyl)benzenesulfonate.
| Compound Name | sodium 2-(1-amino-2-carboxyethyl)benzenesulfonate |
|---|---|
| PubChem CID | 170871514 |
| Molecular Formula | C9H10NNaO5S |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | sodium 2-(1-amino-2-carboxyethyl)benzenesulfonate |
| SMILES | NC(CC(=O)O)c1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H11NO5S.Na/c10-7(5-9(11)12)6-3-1-2-4-8(6)16(13,14)15;/h1-4,7H,5,10H2,(H,11,12)(H,13,14,15);/q;+1/p-1 |
| InChIKey | LSEXWPYOWFXWTB-UHFFFAOYSA-M |
| XLogP | -2.93 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|