C15H14N2OS3 — CID 170875791
3-amino-3-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]propanamide (PubChem CID 170875791) has the molecular formula C15H14N2OS3 and a molecular weight of 334.49 g/mol. Its IUPAC name is 3-amino-3-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]propanamide.
| Compound Name | 3-amino-3-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]propanamide |
|---|---|
| PubChem CID | 170875791 |
| Molecular Formula | C15H14N2OS3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-amino-3-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]propanamide |
| SMILES | NC(=O)CC(N)c1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C15H14N2OS3/c16-9(8-15(17)18)10-3-4-13(20-10)14-6-5-12(21-14)11-2-1-7-19-11/h1-7,9H,8,16H2,(H2,17,18) |
| InChIKey | UGRSIYJIXRZWOF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |