C10H7Cl3OS2 — CID 134097787
2,2,2-trichloro-1-(5-thiophen-2-ylthiophen-2-yl)ethanol (PubChem CID 134097787) has the molecular formula C10H7Cl3OS2 and a molecular weight of 313.66 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(5-thiophen-2-ylthiophen-2-yl)ethanol.
| Compound Name | 2,2,2-trichloro-1-(5-thiophen-2-ylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 134097787 |
| Molecular Formula | C10H7Cl3OS2 |
| Molecular Weight | 313.66 g/mol |
| Exact Mass | 311.90 |
| IUPAC Name | 2,2,2-trichloro-1-(5-thiophen-2-ylthiophen-2-yl)ethanol |
| SMILES | OC(c1ccc(-c2cccs2)s1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl3OS2/c11-10(12,13)9(14)8-4-3-7(16-8)6-2-1-5-15-6/h1-5,9,14H |
| InChIKey | CHVFCNARKALPQX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|