C27H23NO4S — CID 170881817
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyl-1-benzothiophen-2-yl)propanoic acid (PubChem CID 170881817) has the molecular formula C27H23NO4S and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyl-1-benzothiophen-2-yl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyl-1-benzothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170881817 |
| Molecular Formula | C27H23NO4S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyl-1-benzothiophen-2-yl)propanoic acid |
| SMILES | Cc1c(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C27H23NO4S/c1-16-17-8-6-7-13-24(17)33-25(16)14-23(26(29)30)28-27(31)32-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | LFYOQMZHXLXLNL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |